ChemNet > CAS > 261762-82-7 2-Chloro-6-fluoro-3-methylbenzoyl chloride
261762-82-7 2-Chloro-6-fluoro-3-methylbenzoyl chloride
| Produkt-Name |
2-Chloro-6-fluoro-3-methylbenzoyl chloride |
| Synonyme |
2-Chloro-6-fluoro-m-toluoyl chloride |
| Molekulare Formel |
C8H5Cl2FO |
| Molecular Weight |
207.0291 |
| InChI |
InChI=1/C8H5Cl2FO/c1-4-2-3-5(11)6(7(4)9)8(10)12/h2-3H,1H3 |
| CAS Registry Number |
261762-82-7 |
| Molecular Structure |
|
| Dichte |
1.396g/cm3 |
| Siedepunkt |
245.6°C at 760 mmHg |
| Brechungsindex |
1.535 |
| Flammpunkt |
102.3°C |
| Gefahrensymbole |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
